C11H11NO3S — CID 125472108
ethyl 2-acetyl-4H-thieno[3,2-b]pyrrole-5-carboxylate (PubChem CID 125472108) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is ethyl 2-acetyl-4H-thieno[3,2-b]pyrrole-5-carboxylate.
| Compound Name | ethyl 2-acetyl-4H-thieno[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 125472108 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | ethyl 2-acetyl-4H-thieno[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2sc(C(C)=O)cc2[nH]1 |
| InChI | InChI=1S/C11H11NO3S/c1-3-15-11(14)8-5-10-7(12-8)4-9(16-10)6(2)13/h4-5,12H,3H2,1-2H3 |
| InChIKey | MEAMVLXKEYWNOT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |