C9H8ClNO2S — CID 57348924
ethyl 3-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate (PubChem CID 57348924) has the molecular formula C9H8ClNO2S and a molecular weight of 229.69 g/mol. Its IUPAC name is ethyl 3-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate.
| Compound Name | ethyl 3-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 57348924 |
| Molecular Formula | C9H8ClNO2S |
| Molecular Weight | 229.69 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | ethyl 3-chloro-4H-thieno[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2scc(Cl)c2[nH]1 |
| InChI | InChI=1S/C9H8ClNO2S/c1-2-13-9(12)6-3-7-8(11-6)5(10)4-14-7/h3-4,11H,2H2,1H3 |
| InChIKey | YUIDGONLMDUWNF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.69 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |