C10H14N2Si — CID 15350909
trimethyl(1H-pyrrolo[2,3-c]pyridin-2-yl)silane (PubChem CID 15350909) has the molecular formula C10H14N2Si and a molecular weight of 190.32 g/mol. Its IUPAC name is trimethyl(1H-pyrrolo[2,3-c]pyridin-2-yl)silane.
| Compound Name | trimethyl(1H-pyrrolo[2,3-c]pyridin-2-yl)silane |
|---|---|
| PubChem CID | 15350909 |
| Molecular Formula | C10H14N2Si |
| Molecular Weight | 190.32 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | trimethyl(1H-pyrrolo[2,3-c]pyridin-2-yl)silane |
| SMILES | C[Si](C)(C)c1cc2ccncc2[nH]1 |
| InChI | InChI=1S/C10H14N2Si/c1-13(2,3)10-6-8-4-5-11-7-9(8)12-10/h4-7,12H,1-3H3 |
| InChIKey | NVLMWCYBRWLKEH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|