C10H11N3O2 — CID 25132327
N-ethoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxamide (PubChem CID 25132327) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is N-ethoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxamide.
| Compound Name | N-ethoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 25132327 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | N-ethoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxamide |
| SMILES | CCONC(=O)c1cc2ccncc2[nH]1 |
| InChI | InChI=1S/C10H11N3O2/c1-2-15-13-10(14)8-5-7-3-4-11-6-9(7)12-8/h3-6,12H,2H2,1H3,(H,13,14) |
| InChIKey | AZIWQCXJRKDWRZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|