C20H32N4O — CID 142971343
(Z)-but-2-ene;N-[2-[[(E)-but-2-en-2-yl]amino]ethyl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide;ethane (PubChem CID 142971343) has the molecular formula C20H32N4O and a molecular weight of 344.50 g/mol. Its IUPAC name is (Z)-but-2-ene;N-[2-[[(E)-but-2-en-2-yl]amino]ethyl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide;ethane.
| Compound Name | (Z)-but-2-ene;N-[2-[[(E)-but-2-en-2-yl]amino]ethyl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 142971343 |
| Molecular Formula | C20H32N4O |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | (Z)-but-2-ene;N-[2-[[(E)-but-2-en-2-yl]amino]ethyl]-1H-pyrrolo[2,3-c]pyridine-2-carboxamide;ethane |
| SMILES | C/C=C(\C)NCCNC(=O)c1cc2ccncc2[nH]1.C/C=C\C.CC |
| InChI | InChI=1S/C14H18N4O.C4H8.C2H6/c1-3-10(2)16-6-7-17-14(19)12-8-11-4-5-15-9-13(11)18-12;1-3-4-2;1-2/h3-5,8-9,16,18H,6-7H2,1-2H3,(H,17,19);3-4H,1-2H3;1-2H3/b10-3+;4-3-; |
| InChIKey | ONZJHBPHOLPMPY-VDIAZQLHSA-N |
| XLogP | 4.41 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|