C8H10N2O3 — CID 107261536
N-ethoxy-6-oxo-1H-pyridine-2-carboxamide (PubChem CID 107261536) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is N-ethoxy-6-oxo-1H-pyridine-2-carboxamide.
| Compound Name | N-ethoxy-6-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107261536 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | N-ethoxy-6-oxo-1H-pyridine-2-carboxamide |
| SMILES | CCONC(=O)c1cccc(=O)[nH]1 |
| InChI | InChI=1S/C8H10N2O3/c1-2-13-10-8(12)6-4-3-5-7(11)9-6/h3-5H,2H2,1H3,(H,9,11)(H,10,12) |
| InChIKey | UXZIMIYZUAWBJC-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|