C13H15N5O2 — CID 175745710
N-ethoxy-6-[(2-methylpyrimidin-4-yl)amino]pyridine-3-carboxamide (PubChem CID 175745710) has the molecular formula C13H15N5O2 and a molecular weight of 273.30 g/mol. Its IUPAC name is N-ethoxy-6-[(2-methylpyrimidin-4-yl)amino]pyridine-3-carboxamide.
| Compound Name | N-ethoxy-6-[(2-methylpyrimidin-4-yl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175745710 |
| Molecular Formula | C13H15N5O2 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | N-ethoxy-6-[(2-methylpyrimidin-4-yl)amino]pyridine-3-carboxamide |
| SMILES | CCONC(=O)c1ccc(Nc2ccnc(C)n2)nc1 |
| InChI | InChI=1S/C13H15N5O2/c1-3-20-18-13(19)10-4-5-11(15-8-10)17-12-6-7-14-9(2)16-12/h4-8H,3H2,1-2H3,(H,18,19)(H,14,15,16,17) |
| InChIKey | WWJLANIDSXSZNA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|