C12H10N2O2 — CID 68982252
furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol (PubChem CID 68982252) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol.
| Compound Name | furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol |
|---|---|
| PubChem CID | 68982252 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol |
| SMILES | OC(c1ccoc1)c1cc2ccncc2[nH]1 |
| InChI | InChI=1S/C12H10N2O2/c15-12(9-2-4-16-7-9)10-5-8-1-3-13-6-11(8)14-10/h1-7,12,14-15H |
| InChIKey | ITGWAODVACZYNL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |