About furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol
furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol (PubChem CID 68982252) has the molecular formula C12H10N2O2
and a molecular weight of 214.22 g/mol. Its IUPAC name is furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol.
Molecular Properties
| Compound Name | furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol |
| PubChem CID | 68982252 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol |
| SMILES | OC(c1ccoc1)c1cc2ccncc2[nH]1 |
| InChI | InChI=1S/C12H10N2O2/c15-12(9-2-4-16-7-9)10-5-8-1-3-13-6-11(8)14-10/h1-7,12,14-15H |
| InChIKey | ITGWAODVACZYNL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol?
The IUPAC name of furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol (CID 68982252) is furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol.
What is the SMILES notation for furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol?
The canonical SMILES for furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol is OC(c1ccoc1)c1cc2ccncc2[nH]1.
What is the InChIKey of furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol?
The InChIKey is ITGWAODVACZYNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2/c15-12(9-2-4-16-7-9)10-5-8-1-3-13-6-11(8)14-10/h1-7,12,14-15H.
What are the key properties of furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol?
furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol has a molecular weight of 214.22 g/mol, XLogP of 2.24, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-3-yl(1H-pyrrolo[2,3-c]pyridin-2-yl)methanol is sourced from PubChem (CID 68982252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).