C12H10N2OS — CID 99645756
(S)-1H-pyrrolo[2,3-c]pyridin-2-yl(thiophen-3-yl)methanol (PubChem CID 99645756) has the molecular formula C12H10N2OS and a molecular weight of 230.29 g/mol. Its IUPAC name is (S)-1H-pyrrolo[2,3-c]pyridin-2-yl(thiophen-3-yl)methanol.
| Compound Name | (S)-1H-pyrrolo[2,3-c]pyridin-2-yl(thiophen-3-yl)methanol |
|---|---|
| PubChem CID | 99645756 |
| Molecular Formula | C12H10N2OS |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | (S)-1H-pyrrolo[2,3-c]pyridin-2-yl(thiophen-3-yl)methanol |
| SMILES | O[C@@H](c1ccsc1)c1cc2ccncc2[nH]1 |
| InChI | InChI=1S/C12H10N2OS/c15-12(9-2-4-16-7-9)10-5-8-1-3-13-6-11(8)14-10/h1-7,12,14-15H/t12-/m0/s1 |
| InChIKey | MNJCMBLUMKRQNG-LBPRGKRZSA-N |
| XLogP | 2.71 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |