C11H7NO3 — CID 118518283
7-hydroxy-1H-[1]benzofuro[2,3-b]pyridin-2-one (PubChem CID 118518283) has the molecular formula C11H7NO3 and a molecular weight of 201.18 g/mol. Its IUPAC name is 7-hydroxy-1H-[1]benzofuro[2,3-b]pyridin-2-one.
| Compound Name | 7-hydroxy-1H-[1]benzofuro[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 118518283 |
| Molecular Formula | C11H7NO3 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 7-hydroxy-1H-[1]benzofuro[2,3-b]pyridin-2-one |
| SMILES | O=c1ccc2c([nH]1)oc1cc(O)ccc12 |
| InChI | InChI=1S/C11H7NO3/c13-6-1-2-7-8-3-4-10(14)12-11(8)15-9(7)5-6/h1-5,13H,(H,12,14) |
| InChIKey | SWNGPLQNGGKHBL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |