C8H5NO3S — CID 11446889
7-hydroxy-2-sulfanylidene-1,3-benzoxazin-4-one (PubChem CID 11446889) has the molecular formula C8H5NO3S and a molecular weight of 195.20 g/mol. Its IUPAC name is 7-hydroxy-2-sulfanylidene-1,3-benzoxazin-4-one.
| Compound Name | 7-hydroxy-2-sulfanylidene-1,3-benzoxazin-4-one |
|---|---|
| PubChem CID | 11446889 |
| Molecular Formula | C8H5NO3S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | 7-hydroxy-2-sulfanylidene-1,3-benzoxazin-4-one |
| SMILES | O=c1[nH]c(=S)oc2cc(O)ccc12 |
| InChI | InChI=1S/C8H5NO3S/c10-4-1-2-5-6(3-4)12-8(13)9-7(5)11/h1-3,10H,(H,9,11,13) |
| InChIKey | PLMBOAIOWHYHOL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|