C6H7N3O — CID 141134861
6H-furo[2,3-b]pyrrole-4,5-diamine (PubChem CID 141134861) has the molecular formula C6H7N3O and a molecular weight of 137.14 g/mol. Its IUPAC name is 6H-furo[2,3-b]pyrrole-4,5-diamine.
| Compound Name | 6H-furo[2,3-b]pyrrole-4,5-diamine |
|---|---|
| PubChem CID | 141134861 |
| Molecular Formula | C6H7N3O |
| Molecular Weight | 137.14 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | 6H-furo[2,3-b]pyrrole-4,5-diamine |
| SMILES | Nc1[nH]c2occc2c1N |
| InChI | InChI=1S/C6H7N3O/c7-4-3-1-2-10-6(3)9-5(4)8/h1-2,9H,7-8H2 |
| InChIKey | BJRRHRTWOKNCQP-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 80.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.14 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |