C28H26FN5O4 — CID 141289528
4-[5-(1,3-dioxol-2-yl)-2-fluoro-3-pyridinyl]-N,N-bis[(4-methoxyphenyl)methyl]-6-methyl-1,3,5-triazin-2-amine (PubChem CID 141289528) has the molecular formula C28H26FN5O4 and a molecular weight of 515.55 g/mol. Its IUPAC name is 4-[5-(1,3-dioxol-2-yl)-2-fluoro-3-pyridinyl]-N,N-bis[(4-methoxyphenyl)methyl]-6-methyl-1,3,5-triazin-2-amine.
| Compound Name | 4-[5-(1,3-dioxol-2-yl)-2-fluoro-3-pyridinyl]-N,N-bis[(4-methoxyphenyl)methyl]-6-methyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 141289528 |
| Molecular Formula | C28H26FN5O4 |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 4-[5-(1,3-dioxol-2-yl)-2-fluoro-3-pyridinyl]-N,N-bis[(4-methoxyphenyl)methyl]-6-methyl-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2nc(C)nc(-c3cc(C4OC=CO4)cnc3F)n2)cc1 |
| InChI | InChI=1S/C28H26FN5O4/c1-18-31-26(24-14-21(15-30-25(24)29)27-37-12-13-38-27)33-28(32-18)34(16-19-4-8-22(35-2)9-5-19)17-20-6-10-23(36-3)11-7-20/h4-15,27H,16-17H2,1-3H3 |
| InChIKey | IPFNIMJBEJTHOB-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 91.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|