C27H26FN5O4 — CID 68515012
2-[5-[4-[bis[(4-methoxyphenyl)methyl]amino]-6-methyl-1,3,5-triazin-2-yl]-6-fluoro-3-pyridinyl]acetic acid (PubChem CID 68515012) has the molecular formula C27H26FN5O4 and a molecular weight of 503.53 g/mol. Its IUPAC name is 2-[5-[4-[bis[(4-methoxyphenyl)methyl]amino]-6-methyl-1,3,5-triazin-2-yl]-6-fluoro-3-pyridinyl]acetic acid.
| Compound Name | 2-[5-[4-[bis[(4-methoxyphenyl)methyl]amino]-6-methyl-1,3,5-triazin-2-yl]-6-fluoro-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 68515012 |
| Molecular Formula | C27H26FN5O4 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 2-[5-[4-[bis[(4-methoxyphenyl)methyl]amino]-6-methyl-1,3,5-triazin-2-yl]-6-fluoro-3-pyridinyl]acetic acid |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2nc(C)nc(-c3cc(CC(=O)O)cnc3F)n2)cc1 |
| InChI | InChI=1S/C27H26FN5O4/c1-17-30-26(23-12-20(13-24(34)35)14-29-25(23)28)32-27(31-17)33(15-18-4-8-21(36-2)9-5-18)16-19-6-10-22(37-3)11-7-19/h4-12,14H,13,15-16H2,1-3H3,(H,34,35) |
| InChIKey | CIEPIGBUALILFB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 110.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|