C17H21FN2O — CID 141290235
5-(4-fluorophenyl)-3-(4-propylcyclohexyl)-1,2,4-oxadiazole (PubChem CID 141290235) has the molecular formula C17H21FN2O and a molecular weight of 288.37 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3-(4-propylcyclohexyl)-1,2,4-oxadiazole.
| Compound Name | 5-(4-fluorophenyl)-3-(4-propylcyclohexyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 141290235 |
| Molecular Formula | C17H21FN2O |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 5-(4-fluorophenyl)-3-(4-propylcyclohexyl)-1,2,4-oxadiazole |
| SMILES | CCCC1CCC(c2noc(-c3ccc(F)cc3)n2)CC1 |
| InChI | InChI=1S/C17H21FN2O/c1-2-3-12-4-6-13(7-5-12)16-19-17(21-20-16)14-8-10-15(18)11-9-14/h8-13H,2-7H2,1H3 |
| InChIKey | ATNJIPPQBMMXSE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |