C22H32N2O2 — CID 3095315
5-(4-butoxyphenyl)-3-(4-butylcyclohexyl)-1,2,4-oxadiazole (PubChem CID 3095315) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-3-(4-butylcyclohexyl)-1,2,4-oxadiazole.
| Compound Name | 5-(4-butoxyphenyl)-3-(4-butylcyclohexyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 3095315 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 5-(4-butoxyphenyl)-3-(4-butylcyclohexyl)-1,2,4-oxadiazole |
| SMILES | CCCCOc1ccc(-c2nc(C3CCC(CCCC)CC3)no2)cc1 |
| InChI | InChI=1S/C22H32N2O2/c1-3-5-7-17-8-10-18(11-9-17)21-23-22(26-24-21)19-12-14-20(15-13-19)25-16-6-4-2/h12-15,17-18H,3-11,16H2,1-2H3 |
| InChIKey | MRIGWDAYHACJIA-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|