C19H24N4O — CID 11301774
5-[3-(4-pentylcyclohexyl)-1,2,4-oxadiazol-5-yl]pyridine-2-carbonitrile (PubChem CID 11301774) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is 5-[3-(4-pentylcyclohexyl)-1,2,4-oxadiazol-5-yl]pyridine-2-carbonitrile.
| Compound Name | 5-[3-(4-pentylcyclohexyl)-1,2,4-oxadiazol-5-yl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 11301774 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 5-[3-(4-pentylcyclohexyl)-1,2,4-oxadiazol-5-yl]pyridine-2-carbonitrile |
| SMILES | CCCCCC1CCC(c2noc(-c3ccc(C#N)nc3)n2)CC1 |
| InChI | InChI=1S/C19H24N4O/c1-2-3-4-5-14-6-8-15(9-7-14)18-22-19(24-23-18)16-10-11-17(12-20)21-13-16/h10-11,13-15H,2-9H2,1H3 |
| InChIKey | LGLPKSIGGXNLLT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 75.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|