C24H29N3O — CID 3417863
5-[4-(4-pentylcyclohexyl)phenyl]-3-pyridin-3-yl-1,2,4-oxadiazole (PubChem CID 3417863) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is 5-[4-(4-pentylcyclohexyl)phenyl]-3-pyridin-3-yl-1,2,4-oxadiazole.
| Compound Name | 5-[4-(4-pentylcyclohexyl)phenyl]-3-pyridin-3-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 3417863 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 5-[4-(4-pentylcyclohexyl)phenyl]-3-pyridin-3-yl-1,2,4-oxadiazole |
| SMILES | CCCCCC1CCC(c2ccc(-c3nc(-c4cccnc4)no3)cc2)CC1 |
| InChI | InChI=1S/C24H29N3O/c1-2-3-4-6-18-8-10-19(11-9-18)20-12-14-21(15-13-20)24-26-23(27-28-24)22-7-5-16-25-17-22/h5,7,12-19H,2-4,6,8-11H2,1H3 |
| InChIKey | CPDKSEASJDCPNW-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|