C19H27N3O — CID 5008897
5-(4-hexylcyclohexyl)-3-pyridin-4-yl-1,2,4-oxadiazole (PubChem CID 5008897) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is 5-(4-hexylcyclohexyl)-3-pyridin-4-yl-1,2,4-oxadiazole.
| Compound Name | 5-(4-hexylcyclohexyl)-3-pyridin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 5008897 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | 5-(4-hexylcyclohexyl)-3-pyridin-4-yl-1,2,4-oxadiazole |
| SMILES | CCCCCCC1CCC(c2nc(-c3ccncc3)no2)CC1 |
| InChI | InChI=1S/C19H27N3O/c1-2-3-4-5-6-15-7-9-17(10-8-15)19-21-18(22-23-19)16-11-13-20-14-12-16/h11-15,17H,2-10H2,1H3 |
| InChIKey | FONPYAVSAWOAEN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|