C14H17N3O3 — CID 143066864
[4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)cyclohexyl]methanediol (PubChem CID 143066864) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is [4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)cyclohexyl]methanediol.
| Compound Name | [4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)cyclohexyl]methanediol |
|---|---|
| PubChem CID | 143066864 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | [4-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)cyclohexyl]methanediol |
| SMILES | OC(O)C1CCC(c2nc(-c3ccncc3)no2)CC1 |
| InChI | InChI=1S/C14H17N3O3/c18-14(19)11-3-1-10(2-4-11)13-16-12(17-20-13)9-5-7-15-8-6-9/h5-8,10-11,14,18-19H,1-4H2 |
| InChIKey | LNWVLUFIGLNXLX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|