C17H24N4O — CID 11472119
3-(4-pentylcyclohexyl)-5-pyrazin-2-yl-1,2,4-oxadiazole (PubChem CID 11472119) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 3-(4-pentylcyclohexyl)-5-pyrazin-2-yl-1,2,4-oxadiazole.
| Compound Name | 3-(4-pentylcyclohexyl)-5-pyrazin-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 11472119 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 3-(4-pentylcyclohexyl)-5-pyrazin-2-yl-1,2,4-oxadiazole |
| SMILES | CCCCCC1CCC(c2noc(-c3cnccn3)n2)CC1 |
| InChI | InChI=1S/C17H24N4O/c1-2-3-4-5-13-6-8-14(9-7-13)16-20-17(22-21-16)15-12-18-10-11-19-15/h10-14H,2-9H2,1H3 |
| InChIKey | RHTPBQBEWGMQIT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|