C18H27N3O — CID 143066868
3-cyclohexyl-5-pyridin-4-yl-1,2,4-oxadiazole;pentane (PubChem CID 143066868) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is 3-cyclohexyl-5-pyridin-4-yl-1,2,4-oxadiazole;pentane.
| Compound Name | 3-cyclohexyl-5-pyridin-4-yl-1,2,4-oxadiazole;pentane |
|---|---|
| PubChem CID | 143066868 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 3-cyclohexyl-5-pyridin-4-yl-1,2,4-oxadiazole;pentane |
| SMILES | CCCCC.c1cc(-c2nc(C3CCCCC3)no2)ccn1 |
| InChI | InChI=1S/C13H15N3O.C5H12/c1-2-4-10(5-3-1)12-15-13(17-16-12)11-6-8-14-9-7-11;1-3-5-4-2/h6-10H,1-5H2;3-5H2,1-2H3 |
| InChIKey | QTQUJOUBVLMPJC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |