2-(2-sulfohydrazinyl)acetic acid

C2H6N2O5S — CID 141291172

IUPAC2-(2-sulfohydrazinyl)acetic acid
SMILESO=C(O)CNNS(=O)(=O)O
InChIInChI=1S/C2H6N2O5S/c5-2(6)1-3-4-10(7,8)9/h3-4H,1H2,(H,5,6)(H,7,8,9)
InChIKeyWDNISJNNMLJYHA-UHFFFAOYSA-N
MW170.15 g/mol
LogP-2.03
Rot. Bonds4

About 2-(2-sulfohydrazinyl)acetic acid

2-(2-sulfohydrazinyl)acetic acid (PubChem CID 141291172) has the molecular formula C2H6N2O5S and a molecular weight of 170.15 g/mol. Its IUPAC name is 2-(2-sulfohydrazinyl)acetic acid.

Molecular Properties

Compound Name2-(2-sulfohydrazinyl)acetic acid
PubChem CID141291172
Molecular FormulaC2H6N2O5S
Molecular Weight170.15 g/mol
Exact Mass170.00
IUPAC Name2-(2-sulfohydrazinyl)acetic acid
SMILESO=C(O)CNNS(=O)(=O)O
InChIInChI=1S/C2H6N2O5S/c5-2(6)1-3-4-10(7,8)9/h3-4H,1H2,(H,5,6)(H,7,8,9)
InChIKeyWDNISJNNMLJYHA-UHFFFAOYSA-N
XLogP-2.03
TPSA115.73 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.15
LogP ≤ 5-2.03
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-(2-sulfohydrazinyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(carboxyamino)acetic acid;sulfuric acid
CID 87228691
2-[(hydroxy-methylidene-oxo-λ6-sulfanyl)amino]acetic acid
CID 90757657
2-(sulfomethylsulfonylamino)acetic acid
CID 175277486
2-(carboxymethylamino)acetic acid
CID 8897
2-(2-propylhydrazinyl)acetic acid
CID 140974960
2-(carboxymethylamino)acetic acid;cobalt
CID 87306494
benzene;(carbamoylamino)sulfamic acid
CID 67847711
(2S)-2-[2-(carboxymethylamino)hydrazinyl]-3-hydroxypropanoic acid
CID 87754486
2-(16-sulfohexadecylamino)acetic acid
CID 22833417
acetic acid;methanesulfonic acid;propanoic acid
CID 87710299
3-amino-3-oxopropanoic acid;sulfuric acid
CID 71430427
calcium;propanedioic acid;dichloride
CID 172710665

Frequently Asked Questions

What is the IUPAC name of 2-(2-sulfohydrazinyl)acetic acid?
The IUPAC name of 2-(2-sulfohydrazinyl)acetic acid (CID 141291172) is 2-(2-sulfohydrazinyl)acetic acid.
What is the SMILES notation for 2-(2-sulfohydrazinyl)acetic acid?
The canonical SMILES for 2-(2-sulfohydrazinyl)acetic acid is O=C(O)CNNS(=O)(=O)O.
What is the InChIKey of 2-(2-sulfohydrazinyl)acetic acid?
The InChIKey is WDNISJNNMLJYHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O5S/c5-2(6)1-3-4-10(7,8)9/h3-4H,1H2,(H,5,6)(H,7,8,9).
What are the key properties of 2-(2-sulfohydrazinyl)acetic acid?
2-(2-sulfohydrazinyl)acetic acid has a molecular weight of 170.15 g/mol, XLogP of -2.03, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-sulfohydrazinyl)acetic acid is sourced from PubChem (CID 141291172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).