C13H10F3NO — CID 141292979
N-[1-(trifluoromethyl)cyclopropyl]pentalene-1-carboxamide (PubChem CID 141292979) has the molecular formula C13H10F3NO and a molecular weight of 253.22 g/mol. Its IUPAC name is N-[1-(trifluoromethyl)cyclopropyl]pentalene-1-carboxamide.
| Compound Name | N-[1-(trifluoromethyl)cyclopropyl]pentalene-1-carboxamide |
|---|---|
| PubChem CID | 141292979 |
| Molecular Formula | C13H10F3NO |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | N-[1-(trifluoromethyl)cyclopropyl]pentalene-1-carboxamide |
| SMILES | O=C(NC1(C(F)(F)F)CC1)C1=C2C=CC=C2C=C1 |
| InChI | InChI=1S/C13H10F3NO/c14-13(15,16)12(6-7-12)17-11(18)10-5-4-8-2-1-3-9(8)10/h1-5H,6-7H2,(H,17,18) |
| InChIKey | XRJZBTRTQUZURD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |