C14H12F3NO — CID 141293234
N-[1-(trifluoromethyl)cyclobutyl]pentalene-1-carboxamide (PubChem CID 141293234) has the molecular formula C14H12F3NO and a molecular weight of 267.25 g/mol. Its IUPAC name is N-[1-(trifluoromethyl)cyclobutyl]pentalene-1-carboxamide.
| Compound Name | N-[1-(trifluoromethyl)cyclobutyl]pentalene-1-carboxamide |
|---|---|
| PubChem CID | 141293234 |
| Molecular Formula | C14H12F3NO |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | N-[1-(trifluoromethyl)cyclobutyl]pentalene-1-carboxamide |
| SMILES | O=C(NC1(C(F)(F)F)CCC1)C1=C2C=CC=C2C=C1 |
| InChI | InChI=1S/C14H12F3NO/c15-14(16,17)13(7-2-8-13)18-12(19)11-6-5-9-3-1-4-10(9)11/h1,3-6H,2,7-8H2,(H,18,19) |
| InChIKey | NVZMDDVZEBQUHU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |