C14H15NO — CID 141293193
N-(1-methylcyclobutyl)pentalene-1-carboxamide (PubChem CID 141293193) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is N-(1-methylcyclobutyl)pentalene-1-carboxamide.
| Compound Name | N-(1-methylcyclobutyl)pentalene-1-carboxamide |
|---|---|
| PubChem CID | 141293193 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | N-(1-methylcyclobutyl)pentalene-1-carboxamide |
| SMILES | CC1(NC(=O)C2=CC=C3C=CC=C32)CCC1 |
| InChI | InChI=1S/C14H15NO/c1-14(8-3-9-14)15-13(16)12-7-6-10-4-2-5-11(10)12/h2,4-7H,3,8-9H2,1H3,(H,15,16) |
| InChIKey | IKRMLMIKVVJODS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |