C17H17F3N2O — CID 141292998
N-[(3R)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]tricyclo[4.3.0.02,4]nona-1(9),2(4),5,7-tetraene-7-carboxamide (PubChem CID 141292998) has the molecular formula C17H17F3N2O and a molecular weight of 322.33 g/mol. Its IUPAC name is N-[(3R)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]tricyclo[4.3.0.02,4]nona-1(9),2(4),5,7-tetraene-7-carboxamide.
| Compound Name | N-[(3R)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]tricyclo[4.3.0.02,4]nona-1(9),2(4),5,7-tetraene-7-carboxamide |
|---|---|
| PubChem CID | 141292998 |
| Molecular Formula | C17H17F3N2O |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[(3R)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]tricyclo[4.3.0.02,4]nona-1(9),2(4),5,7-tetraene-7-carboxamide |
| SMILES | O=C(N[C@@H]1CCN(CCC(F)(F)F)C1)C1=CC=C2C1=CC1=C2C1 |
| InChI | InChI=1S/C17H17F3N2O/c18-17(19,20)4-6-22-5-3-11(9-22)21-16(23)13-2-1-12-14-7-10(14)8-15(12)13/h1-2,8,11H,3-7,9H2,(H,21,23)/t11-/m1/s1 |
| InChIKey | OBJZKCAPAIEQMG-LLVKDONJSA-N |
| XLogP | 2.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |