C15H15F3N4O — CID 172833985
N-[(3R)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),2(4),5,7-tetraene-7-carboxamide (PubChem CID 172833985) has the molecular formula C15H15F3N4O and a molecular weight of 324.31 g/mol. Its IUPAC name is N-[(3R)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),2(4),5,7-tetraene-7-carboxamide.
| Compound Name | N-[(3R)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),2(4),5,7-tetraene-7-carboxamide |
|---|---|
| PubChem CID | 172833985 |
| Molecular Formula | C15H15F3N4O |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-[(3R)-1-(3,3,3-trifluoropropyl)pyrrolidin-3-yl]-8,9-diazatricyclo[4.3.0.02,4]nona-1(9),2(4),5,7-tetraene-7-carboxamide |
| SMILES | O=C(N[C@@H]1CCN(CCC(F)(F)F)C1)C1=NN=C2C1=CC1=C2C1 |
| InChI | InChI=1S/C15H15F3N4O/c16-15(17,18)2-4-22-3-1-9(7-22)19-14(23)13-11-6-8-5-10(8)12(11)20-21-13/h6,9H,1-5,7H2,(H,19,23)/t9-/m1/s1 |
| InChIKey | VXAUMNYQCDNWBE-SECBINFHSA-N |
| XLogP | 1.58 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |