C25H22F3N3O3S — CID 141293441
4-[5-[2-benzyl-5-(trifluoromethyl)indol-1-yl]sulfonyl-2-pyridinyl]morpholine (PubChem CID 141293441) has the molecular formula C25H22F3N3O3S and a molecular weight of 501.53 g/mol. Its IUPAC name is 4-[5-[2-benzyl-5-(trifluoromethyl)indol-1-yl]sulfonyl-2-pyridinyl]morpholine.
| Compound Name | 4-[5-[2-benzyl-5-(trifluoromethyl)indol-1-yl]sulfonyl-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 141293441 |
| Molecular Formula | C25H22F3N3O3S |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | 4-[5-[2-benzyl-5-(trifluoromethyl)indol-1-yl]sulfonyl-2-pyridinyl]morpholine |
| SMILES | O=S(=O)(c1ccc(N2CCOCC2)nc1)n1c(Cc2ccccc2)cc2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C25H22F3N3O3S/c26-25(27,28)20-6-8-23-19(15-20)16-21(14-18-4-2-1-3-5-18)31(23)35(32,33)22-7-9-24(29-17-22)30-10-12-34-13-11-30/h1-9,15-17H,10-14H2 |
| InChIKey | TUDWXUBUTGJRAI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |