C15H15FN2O4 — CID 141295056
methyl 2-[(4-fluorophenyl)methyl]-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate (PubChem CID 141295056) has the molecular formula C15H15FN2O4 and a molecular weight of 306.29 g/mol. Its IUPAC name is methyl 2-[(4-fluorophenyl)methyl]-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate.
| Compound Name | methyl 2-[(4-fluorophenyl)methyl]-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 141295056 |
| Molecular Formula | C15H15FN2O4 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | methyl 2-[(4-fluorophenyl)methyl]-5-methoxy-1-methyl-6-oxopyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(Cc2ccc(F)cc2)n(C)c(=O)c1OC |
| InChI | InChI=1S/C15H15FN2O4/c1-18-11(8-9-4-6-10(16)7-5-9)17-12(15(20)22-3)13(21-2)14(18)19/h4-7H,8H2,1-3H3 |
| InChIKey | NOKKFXHMYZOPSQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |