C22H22N2O4S — CID 141296498
1,5-bis(4-methoxyphenyl)-3-(4-methylthiadiazol-5-yl)pentane-1,5-dione (PubChem CID 141296498) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is 1,5-bis(4-methoxyphenyl)-3-(4-methylthiadiazol-5-yl)pentane-1,5-dione.
| Compound Name | 1,5-bis(4-methoxyphenyl)-3-(4-methylthiadiazol-5-yl)pentane-1,5-dione |
|---|---|
| PubChem CID | 141296498 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 1,5-bis(4-methoxyphenyl)-3-(4-methylthiadiazol-5-yl)pentane-1,5-dione |
| SMILES | COc1ccc(C(=O)CC(CC(=O)c2ccc(OC)cc2)c2snnc2C)cc1 |
| InChI | InChI=1S/C22H22N2O4S/c1-14-22(29-24-23-14)17(12-20(25)15-4-8-18(27-2)9-5-15)13-21(26)16-6-10-19(28-3)11-7-16/h4-11,17H,12-13H2,1-3H3 |
| InChIKey | JJSKAINRKMGWGS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |