C22H22N2O2Se — CID 56681844
(3R)-1-(4-methoxyphenyl)-3-phenyl-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one (PubChem CID 56681844) has the molecular formula C22H22N2O2Se and a molecular weight of 425.39 g/mol. Its IUPAC name is (3R)-1-(4-methoxyphenyl)-3-phenyl-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one.
| Compound Name | (3R)-1-(4-methoxyphenyl)-3-phenyl-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one |
|---|---|
| PubChem CID | 56681844 |
| Molecular Formula | C22H22N2O2Se |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | (3R)-1-(4-methoxyphenyl)-3-phenyl-3-[(4S)-4,5,6,7-tetrahydro-1,2,3-benzoselenadiazol-4-yl]propan-1-one |
| SMILES | COc1ccc(C(=O)C[C@@H](c2ccccc2)[C@@H]2CCCc3[se]nnc32)cc1 |
| InChI | InChI=1S/C22H22N2O2Se/c1-26-17-12-10-16(11-13-17)20(25)14-19(15-6-3-2-4-7-15)18-8-5-9-21-22(18)23-24-27-21/h2-4,6-7,10-13,18-19H,5,8-9,14H2,1H3/t18-,19-/m0/s1 |
| InChIKey | CJIDSTJYMQQSIH-OALUTQOASA-N |
| XLogP | 4.02 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|