About 1H-cyclohepta[b]pyridine-8,9-diol
1H-cyclohepta[b]pyridine-8,9-diol (PubChem CID 141297281) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is 1H-cyclohepta[b]pyridine-8,9-diol.
Molecular Properties
| Compound Name | 1H-cyclohepta[b]pyridine-8,9-diol |
| PubChem CID | 141297281 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 1H-cyclohepta[b]pyridine-8,9-diol |
| SMILES | OC1=CC=CC2=CC=CNC2=C1O |
| InChI | InChI=1S/C10H9NO2/c12-8-5-1-3-7-4-2-6-11-9(7)10(8)13/h1-6,11-13H |
| InChIKey | CVGDOKQHHZLKPK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-cyclohepta[b]pyridine-8,9-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-cyclohepta[b]pyridine-8,9-diol?
The IUPAC name of 1H-cyclohepta[b]pyridine-8,9-diol (CID 141297281) is 1H-cyclohepta[b]pyridine-8,9-diol.
What is the SMILES notation for 1H-cyclohepta[b]pyridine-8,9-diol?
The canonical SMILES for 1H-cyclohepta[b]pyridine-8,9-diol is OC1=CC=CC2=CC=CNC2=C1O.
What is the InChIKey of 1H-cyclohepta[b]pyridine-8,9-diol?
The InChIKey is CVGDOKQHHZLKPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c12-8-5-1-3-7-4-2-6-11-9(7)10(8)13/h1-6,11-13H.
What are the key properties of 1H-cyclohepta[b]pyridine-8,9-diol?
1H-cyclohepta[b]pyridine-8,9-diol has a molecular weight of 175.19 g/mol, XLogP of 1.81, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-cyclohepta[b]pyridine-8,9-diol is sourced from PubChem (CID 141297281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).