C9H9NO — CID 165154010
1,5-dihydroquinolin-8-ol (PubChem CID 165154010) has the molecular formula C9H9NO and a molecular weight of 147.18 g/mol. Its IUPAC name is 1,5-dihydroquinolin-8-ol.
| Compound Name | 1,5-dihydroquinolin-8-ol |
|---|---|
| PubChem CID | 165154010 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 1,5-dihydroquinolin-8-ol |
| SMILES | OC1=C2NC=CC=C2CC=C1 |
| InChI | InChI=1S/C9H9NO/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1-2,4-6,10-11H,3H2 |
| InChIKey | GGQMFCPJOUOVHT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |