C9H9NO — CID 91247829
2,3-dihydroisoquinolin-5-ol (PubChem CID 91247829) has the molecular formula C9H9NO and a molecular weight of 147.18 g/mol. Its IUPAC name is 2,3-dihydroisoquinolin-5-ol.
| Compound Name | 2,3-dihydroisoquinolin-5-ol |
|---|---|
| PubChem CID | 91247829 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 2,3-dihydroisoquinolin-5-ol |
| SMILES | Oc1cccc2c1=CCNC=2 |
| InChI | InChI=1S/C9H9NO/c11-9-3-1-2-7-6-10-5-4-8(7)9/h1-4,6,10-11H,5H2 |
| InChIKey | MXRZYEWXDWKARH-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |