About 2H-2-benzazepin-6-ol;hydrobromide
2H-2-benzazepin-6-ol;hydrobromide (PubChem CID 141074641) has the molecular formula C10H10BrNO
and a molecular weight of 240.10 g/mol. Its IUPAC name is 2H-2-benzazepin-6-ol;hydrobromide.
Molecular Properties
| Compound Name | 2H-2-benzazepin-6-ol;hydrobromide |
| PubChem CID | 141074641 |
| Molecular Formula | C10H10BrNO |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 2H-2-benzazepin-6-ol;hydrobromide |
| SMILES | Br.Oc1cccc2c1=CC=CNC=2 |
| InChI | InChI=1S/C10H9NO.BrH/c12-10-5-1-3-8-7-11-6-2-4-9(8)10;/h1-7,11-12H;1H |
| InChIKey | COEXRNQVVFOVRU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2H-2-benzazepin-6-ol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-2-benzazepin-6-ol;hydrobromide?
The IUPAC name of 2H-2-benzazepin-6-ol;hydrobromide (CID 141074641) is 2H-2-benzazepin-6-ol;hydrobromide.
What is the SMILES notation for 2H-2-benzazepin-6-ol;hydrobromide?
The canonical SMILES for 2H-2-benzazepin-6-ol;hydrobromide is Br.Oc1cccc2c1=CC=CNC=2.
What is the InChIKey of 2H-2-benzazepin-6-ol;hydrobromide?
The InChIKey is COEXRNQVVFOVRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO.BrH/c12-10-5-1-3-8-7-11-6-2-4-9(8)10;/h1-7,11-12H;1H.
What are the key properties of 2H-2-benzazepin-6-ol;hydrobromide?
2H-2-benzazepin-6-ol;hydrobromide has a molecular weight of 240.10 g/mol, XLogP of 0.61, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-2-benzazepin-6-ol;hydrobromide is sourced from PubChem (CID 141074641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).