C8H10N2O — CID 163516824
5,6-bis(aminomethylidene)cyclohexa-1,3-dien-1-ol (PubChem CID 163516824) has the molecular formula C8H10N2O and a molecular weight of 150.18 g/mol. Its IUPAC name is 5,6-bis(aminomethylidene)cyclohexa-1,3-dien-1-ol.
| Compound Name | 5,6-bis(aminomethylidene)cyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 163516824 |
| Molecular Formula | C8H10N2O |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 5,6-bis(aminomethylidene)cyclohexa-1,3-dien-1-ol |
| SMILES | NC=c1cccc(O)c1=CN |
| InChI | InChI=1S/C8H10N2O/c9-4-6-2-1-3-8(11)7(6)5-10/h1-5,11H,9-10H2 |
| InChIKey | DHLUZONNDHOTRF-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |