C8H11NO — CID 145471802
1-(4-methyl-1,2-dihydropyridin-5-yl)ethenol (PubChem CID 145471802) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 1-(4-methyl-1,2-dihydropyridin-5-yl)ethenol.
| Compound Name | 1-(4-methyl-1,2-dihydropyridin-5-yl)ethenol |
|---|---|
| PubChem CID | 145471802 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 1-(4-methyl-1,2-dihydropyridin-5-yl)ethenol |
| SMILES | C=C(O)C1=CNCC=C1C |
| InChI | InChI=1S/C8H11NO/c1-6-3-4-9-5-8(6)7(2)10/h3,5,9-10H,2,4H2,1H3 |
| InChIKey | CCTGMGDRFJJRFX-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|