C13H11NO — CID 57204550
4a,5-dihydrophenanthridin-10-ol (PubChem CID 57204550) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is 4a,5-dihydrophenanthridin-10-ol.
| Compound Name | 4a,5-dihydrophenanthridin-10-ol |
|---|---|
| PubChem CID | 57204550 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 4a,5-dihydrophenanthridin-10-ol |
| SMILES | Oc1cccc2c1=C1C=CC=CC1NC=2 |
| InChI | InChI=1S/C13H11NO/c15-12-7-3-4-9-8-14-11-6-2-1-5-10(11)13(9)12/h1-8,11,14-15H |
| InChIKey | BWCWFWOQIXSCNQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |