C8H7NO — CID 176545639
1,7a-dihydroindol-5-ol (PubChem CID 176545639) has the molecular formula C8H7NO and a molecular weight of 133.15 g/mol. Its IUPAC name is 1,7a-dihydroindol-5-ol.
| Compound Name | 1,7a-dihydroindol-5-ol |
|---|---|
| PubChem CID | 176545639 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | 1,7a-dihydroindol-5-ol |
| SMILES | OC1=CC2=C=CNC2C=C1 |
| InChI | InChI=1S/C8H7NO/c10-7-1-2-8-6(5-7)3-4-9-8/h1-2,4-5,8-10H |
| InChIKey | WSTUQFBLLYWIQJ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |