C15H11NO — CID 90745817
1-azatetracyclo[6.6.2.04,16.011,15]hexadeca-2,4,6,8,11,13,15-heptaen-13-ol (PubChem CID 90745817) has the molecular formula C15H11NO and a molecular weight of 221.26 g/mol. Its IUPAC name is 1-azatetracyclo[6.6.2.04,16.011,15]hexadeca-2,4,6,8,11,13,15-heptaen-13-ol.
| Compound Name | 1-azatetracyclo[6.6.2.04,16.011,15]hexadeca-2,4,6,8,11,13,15-heptaen-13-ol |
|---|---|
| PubChem CID | 90745817 |
| Molecular Formula | C15H11NO |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 1-azatetracyclo[6.6.2.04,16.011,15]hexadeca-2,4,6,8,11,13,15-heptaen-13-ol |
| SMILES | OC1=CN2C=Cc3cccc4c3=C2C(=C1)CC=4 |
| InChI | InChI=1S/C15H11NO/c17-13-8-12-5-4-10-2-1-3-11-6-7-16(9-13)15(12)14(10)11/h1-4,6-9,17H,5H2 |
| InChIKey | HKURBOFRYAACHK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |