C20H26FNO — CID 141298033
2-[4-[(1R)-2-cyclopentyl-1-(1H-pyrrol-2-yl)ethyl]-2-fluorophenyl]propan-2-ol (PubChem CID 141298033) has the molecular formula C20H26FNO and a molecular weight of 315.43 g/mol. Its IUPAC name is 2-[4-[(1R)-2-cyclopentyl-1-(1H-pyrrol-2-yl)ethyl]-2-fluorophenyl]propan-2-ol.
| Compound Name | 2-[4-[(1R)-2-cyclopentyl-1-(1H-pyrrol-2-yl)ethyl]-2-fluorophenyl]propan-2-ol |
|---|---|
| PubChem CID | 141298033 |
| Molecular Formula | C20H26FNO |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 2-[4-[(1R)-2-cyclopentyl-1-(1H-pyrrol-2-yl)ethyl]-2-fluorophenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc([C@@H](CC2CCCC2)c2ccc[nH]2)cc1F |
| InChI | InChI=1S/C20H26FNO/c1-20(2,23)17-10-9-15(13-18(17)21)16(19-8-5-11-22-19)12-14-6-3-4-7-14/h5,8-11,13-14,16,22-23H,3-4,6-7,12H2,1-2H3/t16-/m1/s1 |
| InChIKey | IXMUZAHDAFRTQS-MRXNPFEDSA-N |
| XLogP | 5.09 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |