C12H19N3O2 — CID 141300351
N-[(3S)-2,5-dimethyl-4-oxohexan-3-yl]-1H-imidazole-5-carboxamide (PubChem CID 141300351) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-[(3S)-2,5-dimethyl-4-oxohexan-3-yl]-1H-imidazole-5-carboxamide.
| Compound Name | N-[(3S)-2,5-dimethyl-4-oxohexan-3-yl]-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 141300351 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-[(3S)-2,5-dimethyl-4-oxohexan-3-yl]-1H-imidazole-5-carboxamide |
| SMILES | CC(C)C(=O)[C@@H](NC(=O)c1cnc[nH]1)C(C)C |
| InChI | InChI=1S/C12H19N3O2/c1-7(2)10(11(16)8(3)4)15-12(17)9-5-13-6-14-9/h5-8,10H,1-4H3,(H,13,14)(H,15,17)/t10-/m0/s1 |
| InChIKey | NZZATLGEXYUXBJ-JTQLQIEISA-N |
| XLogP | 1.39 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |