C22H29ClN2 — CID 141300823
3-(azetidin-1-ylmethyl)-N-[(1R)-1-(4-chloro-3-methylphenyl)propyl]-4-ethylaniline (PubChem CID 141300823) has the molecular formula C22H29ClN2 and a molecular weight of 356.94 g/mol. Its IUPAC name is 3-(azetidin-1-ylmethyl)-N-[(1R)-1-(4-chloro-3-methylphenyl)propyl]-4-ethylaniline.
| Compound Name | 3-(azetidin-1-ylmethyl)-N-[(1R)-1-(4-chloro-3-methylphenyl)propyl]-4-ethylaniline |
|---|---|
| PubChem CID | 141300823 |
| Molecular Formula | C22H29ClN2 |
| Molecular Weight | 356.94 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 3-(azetidin-1-ylmethyl)-N-[(1R)-1-(4-chloro-3-methylphenyl)propyl]-4-ethylaniline |
| SMILES | CCc1ccc(N[C@H](CC)c2ccc(Cl)c(C)c2)cc1CN1CCC1 |
| InChI | InChI=1S/C22H29ClN2/c1-4-17-7-9-20(14-19(17)15-25-11-6-12-25)24-22(5-2)18-8-10-21(23)16(3)13-18/h7-10,13-14,22,24H,4-6,11-12,15H2,1-3H3/t22-/m1/s1 |
| InChIKey | VCBIRDNTNJNCRO-JOCHJYFZSA-N |
| XLogP | 5.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.94 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |