C34H40BrN3O2 — CID 141302849
N-(1-adamantyl)-N-[(6-bromo-2-methoxyquinolin-3-yl)-phenylmethyl]-2-piperidin-2-ylacetamide (PubChem CID 141302849) has the molecular formula C34H40BrN3O2 and a molecular weight of 602.62 g/mol. Its IUPAC name is N-(1-adamantyl)-N-[(6-bromo-2-methoxyquinolin-3-yl)-phenylmethyl]-2-piperidin-2-ylacetamide.
| Compound Name | N-(1-adamantyl)-N-[(6-bromo-2-methoxyquinolin-3-yl)-phenylmethyl]-2-piperidin-2-ylacetamide |
|---|---|
| PubChem CID | 141302849 |
| Molecular Formula | C34H40BrN3O2 |
| Molecular Weight | 602.62 g/mol |
| Exact Mass | 601.23 |
| IUPAC Name | N-(1-adamantyl)-N-[(6-bromo-2-methoxyquinolin-3-yl)-phenylmethyl]-2-piperidin-2-ylacetamide |
| SMILES | COc1nc2ccc(Br)cc2cc1C(c1ccccc1)N(C(=O)CC1CCCCN1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C34H40BrN3O2/c1-40-33-29(17-26-16-27(35)10-11-30(26)37-33)32(25-7-3-2-4-8-25)38(31(39)18-28-9-5-6-12-36-28)34-19-22-13-23(20-34)15-24(14-22)21-34/h2-4,7-8,10-11,16-17,22-24,28,32,36H,5-6,9,12-15,18-21H2,1H3 |
| InChIKey | PDOOANVNAZUSNX-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.62 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |