About 1-(6-bromo-2-methoxyquinolin-3-yl)-3-methylsulfanyl-1,2-diphenylpropan-2-ol
1-(6-bromo-2-methoxyquinolin-3-yl)-3-methylsulfanyl-1,2-diphenylpropan-2-ol (PubChem CID 143687575) has the molecular formula C26H24BrNO2S
and a molecular weight of 494.45 g/mol. Its IUPAC name is 1-(6-bromo-2-methoxyquinolin-3-yl)-3-methylsulfanyl-1,2-diphenylpropan-2-ol.
Molecular Properties
| Compound Name | 1-(6-bromo-2-methoxyquinolin-3-yl)-3-methylsulfanyl-1,2-diphenylpropan-2-ol |
| PubChem CID | 143687575 |
| Molecular Formula | C26H24BrNO2S |
| Molecular Weight | 494.45 g/mol |
| Exact Mass | 493.07 |
| IUPAC Name | 1-(6-bromo-2-methoxyquinolin-3-yl)-3-methylsulfanyl-1,2-diphenylpropan-2-ol |
| SMILES | COc1nc2ccc(Br)cc2cc1C(c1ccccc1)C(O)(CSC)c1ccccc1 |
| InChI | InChI=1S/C26H24BrNO2S/c1-30-25-22(16-19-15-21(27)13-14-23(19)28-25)24(18-9-5-3-6-10-18)26(29,17-31-2)20-11-7-4-8-12-20/h3-16,24,29H,17H2,1-2H3 |
| InChIKey | IFGHGVHPTXBNKK-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.45 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6-bromo-2-methoxyquinolin-3-yl)-3-methylsulfanyl-1,2-diphenylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-bromo-2-methoxyquinolin-3-yl)-3-methylsulfanyl-1,2-diphenylpropan-2-ol?
The IUPAC name of 1-(6-bromo-2-methoxyquinolin-3-yl)-3-methylsulfanyl-1,2-diphenylpropan-2-ol (CID 143687575) is 1-(6-bromo-2-methoxyquinolin-3-yl)-3-methylsulfanyl-1,2-diphenylpropan-2-ol.
What is the SMILES notation for 1-(6-bromo-2-methoxyquinolin-3-yl)-3-methylsulfanyl-1,2-diphenylpropan-2-ol?
The canonical SMILES for 1-(6-bromo-2-methoxyquinolin-3-yl)-3-methylsulfanyl-1,2-diphenylpropan-2-ol is COc1nc2ccc(Br)cc2cc1C(c1ccccc1)C(O)(CSC)c1ccccc1.
What is the InChIKey of 1-(6-bromo-2-methoxyquinolin-3-yl)-3-methylsulfanyl-1,2-diphenylpropan-2-ol?
The InChIKey is IFGHGVHPTXBNKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24BrNO2S/c1-30-25-22(16-19-15-21(27)13-14-23(19)28-25)24(18-9-5-3-6-10-18)26(29,17-31-2)20-11-7-4-8-12-20/h3-16,24,29H,17H2,1-2H3.
What are the key properties of 1-(6-bromo-2-methoxyquinolin-3-yl)-3-methylsulfanyl-1,2-diphenylpropan-2-ol?
1-(6-bromo-2-methoxyquinolin-3-yl)-3-methylsulfanyl-1,2-diphenylpropan-2-ol has a molecular weight of 494.45 g/mol, XLogP of 6.39, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-bromo-2-methoxyquinolin-3-yl)-3-methylsulfanyl-1,2-diphenylpropan-2-ol is sourced from PubChem (CID 143687575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).