C33H34BrN2O2+ — CID 15941001
[4-(6-bromo-2-methoxyquinolin-3-yl)-3-hydroxy-3-naphthalen-1-yl-4-phenylbutyl]-trimethylazanium (PubChem CID 15941001) has the molecular formula C33H34BrN2O2+ and a molecular weight of 570.55 g/mol. Its IUPAC name is [4-(6-bromo-2-methoxyquinolin-3-yl)-3-hydroxy-3-naphthalen-1-yl-4-phenylbutyl]-trimethylazanium.
| Compound Name | [4-(6-bromo-2-methoxyquinolin-3-yl)-3-hydroxy-3-naphthalen-1-yl-4-phenylbutyl]-trimethylazanium |
|---|---|
| PubChem CID | 15941001 |
| Molecular Formula | C33H34BrN2O2+ |
| Molecular Weight | 570.55 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | [4-(6-bromo-2-methoxyquinolin-3-yl)-3-hydroxy-3-naphthalen-1-yl-4-phenylbutyl]-trimethylazanium |
| SMILES | COc1nc2ccc(Br)cc2cc1C(c1ccccc1)C(O)(CC[N+](C)(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C33H34BrN2O2/c1-36(2,3)20-19-33(37,29-16-10-14-23-11-8-9-15-27(23)29)31(24-12-6-5-7-13-24)28-22-25-21-26(34)17-18-30(25)35-32(28)38-4/h5-18,21-22,31,37H,19-20H2,1-4H3/q+1 |
| InChIKey | JIIBCGCYODMFSZ-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.55 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|