C34H36BrIN2O2 — CID 15940999
1-(6-bromo-2-methoxyquinolin-3-yl)-4-[ethyl(dimethyl)azaniumyl]-2-naphthalen-1-yl-1-phenylbutan-2-olate;hydroiodide (PubChem CID 15940999) has the molecular formula C34H36BrIN2O2 and a molecular weight of 711.48 g/mol. Its IUPAC name is 1-(6-bromo-2-methoxyquinolin-3-yl)-4-[ethyl(dimethyl)azaniumyl]-2-naphthalen-1-yl-1-phenylbutan-2-olate;hydroiodide.
| Compound Name | 1-(6-bromo-2-methoxyquinolin-3-yl)-4-[ethyl(dimethyl)azaniumyl]-2-naphthalen-1-yl-1-phenylbutan-2-olate;hydroiodide |
|---|---|
| PubChem CID | 15940999 |
| Molecular Formula | C34H36BrIN2O2 |
| Molecular Weight | 711.48 g/mol |
| Exact Mass | 710.10 |
| IUPAC Name | 1-(6-bromo-2-methoxyquinolin-3-yl)-4-[ethyl(dimethyl)azaniumyl]-2-naphthalen-1-yl-1-phenylbutan-2-olate;hydroiodide |
| SMILES | CC[N+](C)(C)CCC([O-])(c1cccc2ccccc12)C(c1ccccc1)c1cc2cc(Br)ccc2nc1OC.I |
| InChI | InChI=1S/C34H35BrN2O2.HI/c1-5-37(2,3)21-20-34(38,30-17-11-15-24-12-9-10-16-28(24)30)32(25-13-7-6-8-14-25)29-23-26-22-27(35)18-19-31(26)36-33(29)39-4;/h6-19,22-23,32H,5,20-21H2,1-4H3;1H |
| InChIKey | XPSRWTRPYQRKQA-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 45.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.48 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|