C28H28BrIN2O2 — CID 151186743
(1R,2S)-1-(6-bromo-2-methoxyquinolin-3-yl)-4-(dimethylamino)-2-(4-iodophenyl)-1-phenylbutan-2-ol (PubChem CID 151186743) has the molecular formula C28H28BrIN2O2 and a molecular weight of 631.35 g/mol. Its IUPAC name is (1R,2S)-1-(6-bromo-2-methoxyquinolin-3-yl)-4-(dimethylamino)-2-(4-iodophenyl)-1-phenylbutan-2-ol.
| Compound Name | (1R,2S)-1-(6-bromo-2-methoxyquinolin-3-yl)-4-(dimethylamino)-2-(4-iodophenyl)-1-phenylbutan-2-ol |
|---|---|
| PubChem CID | 151186743 |
| Molecular Formula | C28H28BrIN2O2 |
| Molecular Weight | 631.35 g/mol |
| Exact Mass | 630.04 |
| IUPAC Name | (1R,2S)-1-(6-bromo-2-methoxyquinolin-3-yl)-4-(dimethylamino)-2-(4-iodophenyl)-1-phenylbutan-2-ol |
| SMILES | COc1nc2ccc(Br)cc2cc1[C@@H](c1ccccc1)[C@@](O)(CCN(C)C)c1ccc(I)cc1 |
| InChI | InChI=1S/C28H28BrIN2O2/c1-32(2)16-15-28(33,21-9-12-23(30)13-10-21)26(19-7-5-4-6-8-19)24-18-20-17-22(29)11-14-25(20)31-27(24)34-3/h4-14,17-18,26,33H,15-16H2,1-3H3/t26-,28-/m1/s1 |
| InChIKey | NFLVPPURALPHKU-IXCJQBJRSA-N |
| XLogP | 6.58 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.35 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|