C31H33BrN2O4 — CID 59200523
2-(1,3-benzodioxol-5-yl)-1-(6-bromo-2-methoxyquinolin-3-yl)-6-(dimethylamino)-1-phenylhexan-2-ol (PubChem CID 59200523) has the molecular formula C31H33BrN2O4 and a molecular weight of 577.52 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-(6-bromo-2-methoxyquinolin-3-yl)-6-(dimethylamino)-1-phenylhexan-2-ol.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-(6-bromo-2-methoxyquinolin-3-yl)-6-(dimethylamino)-1-phenylhexan-2-ol |
|---|---|
| PubChem CID | 59200523 |
| Molecular Formula | C31H33BrN2O4 |
| Molecular Weight | 577.52 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-(6-bromo-2-methoxyquinolin-3-yl)-6-(dimethylamino)-1-phenylhexan-2-ol |
| SMILES | COc1nc2ccc(Br)cc2cc1C(c1ccccc1)C(O)(CCCCN(C)C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C31H33BrN2O4/c1-34(2)16-8-7-15-31(35,23-11-14-27-28(19-23)38-20-37-27)29(21-9-5-4-6-10-21)25-18-22-17-24(32)12-13-26(22)33-30(25)36-3/h4-6,9-14,17-19,29,35H,7-8,15-16,20H2,1-3H3 |
| InChIKey | ZCUXSDLPHAJOCZ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 64.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.52 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|